About 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one
2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one (PubChem CID 171690440) has the molecular formula C18H18F5N3O
and a molecular weight of 387.35 g/mol. Its IUPAC name is 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one |
| PubChem CID | 171690440 |
| Molecular Formula | C18H18F5N3O |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one |
| SMILES | O=c1ccc(C(F)(F)F)nn1CC1CCN(Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H18F5N3O/c19-14-1-2-15(20)13(9-14)11-25-7-5-12(6-8-25)10-26-17(27)4-3-16(24-26)18(21,22)23/h1-4,9,12H,5-8,10-11H2 |
| InChIKey | FIPKTNMYGBGBHJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one?
The IUPAC name of 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one (CID 171690440) is 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one.
What is the SMILES notation for 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one?
The canonical SMILES for 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one is O=c1ccc(C(F)(F)F)nn1CC1CCN(Cc2cc(F)ccc2F)CC1.
What is the InChIKey of 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one?
The InChIKey is FIPKTNMYGBGBHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F5N3O/c19-14-1-2-15(20)13(9-14)11-25-7-5-12(6-8-25)10-26-17(27)4-3-16(24-26)18(21,22)23/h1-4,9,12H,5-8,10-11H2.
What are the key properties of 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one?
2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one has a molecular weight of 387.35 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-[(2,5-difluorophenyl)methyl]piperidin-4-yl]methyl]-6-(trifluoromethyl)pyridazin-3-one is sourced from PubChem (CID 171690440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).