C16H19F2N3 — CID 90493839
1-[(2,5-difluorophenyl)methyl]-4-(imidazol-1-ylmethyl)piperidine (PubChem CID 90493839) has the molecular formula C16H19F2N3 and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-4-(imidazol-1-ylmethyl)piperidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-4-(imidazol-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 90493839 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-4-(imidazol-1-ylmethyl)piperidine |
| SMILES | Fc1ccc(F)c(CN2CCC(Cn3ccnc3)CC2)c1 |
| InChI | InChI=1S/C16H19F2N3/c17-15-1-2-16(18)14(9-15)11-20-6-3-13(4-7-20)10-21-8-5-19-12-21/h1-2,5,8-9,12-13H,3-4,6-7,10-11H2 |
| InChIKey | PGJVMUZCOHFLAE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |