C18H23FN4O — CID 90493771
N-[(4-fluorophenyl)methyl]-2-[4-(imidazol-1-ylmethyl)piperidin-1-yl]acetamide (PubChem CID 90493771) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(imidazol-1-ylmethyl)piperidin-1-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(imidazol-1-ylmethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 90493771 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(imidazol-1-ylmethyl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(Cn2ccnc2)CC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN4O/c19-17-3-1-15(2-4-17)11-21-18(24)13-22-8-5-16(6-9-22)12-23-10-7-20-14-23/h1-4,7,10,14,16H,5-6,8-9,11-13H2,(H,21,24) |
| InChIKey | AUAAJIQACVNXKS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |