C30H33FN6O3S — CID 166533647
4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-1-oxo-2H-pyrimido[4,5-e]thiazin-3-yl]naphthalen-2-ol (PubChem CID 166533647) has the molecular formula C30H33FN6O3S and a molecular weight of 576.70 g/mol. Its IUPAC name is 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-1-oxo-2H-pyrimido[4,5-e]thiazin-3-yl]naphthalen-2-ol.
| Compound Name | 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-1-oxo-2H-pyrimido[4,5-e]thiazin-3-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 166533647 |
| Molecular Formula | C30H33FN6O3S |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-1-oxo-2H-pyrimido[4,5-e]thiazin-3-yl]naphthalen-2-ol |
| SMILES | O=S1NC(c2cc(O)cc3ccccc23)=Cc2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc(N3CC4CCC(C3)N4)c21 |
| InChI | InChI=1S/C30H33FN6O3S/c31-19-13-30(8-3-9-37(30)14-19)17-40-29-33-26-12-25(24-11-22(38)10-18-4-1-2-5-23(18)24)35-41(39)27(26)28(34-29)36-15-20-6-7-21(16-36)32-20/h1-2,4-5,10-12,19-21,32,35,38H,3,6-9,13-17H2/t19-,20?,21?,30+,41?/m1/s1 |
| InChIKey | IJQLEJHOWQZAHT-GOTMJKIISA-N |
| XLogP | 3.36 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |