C30H33FN6O2S — CID 166534182
4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-2H-pyrimido[4,5-e]thiazin-3-yl]naphthalen-2-ol (PubChem CID 166534182) has the molecular formula C30H33FN6O2S and a molecular weight of 560.70 g/mol. Its IUPAC name is 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-2H-pyrimido[4,5-e]thiazin-3-yl]naphthalen-2-ol.
| Compound Name | 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-2H-pyrimido[4,5-e]thiazin-3-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 166534182 |
| Molecular Formula | C30H33FN6O2S |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-2H-pyrimido[4,5-e]thiazin-3-yl]naphthalen-2-ol |
| SMILES | Oc1cc(C2=Cc3nc(OC[C@@]45CCCN4CC(F)C5)nc(N4CC5CCC(C4)N5)c3SN2)c2ccccc2c1 |
| InChI | InChI=1S/C30H33FN6O2S/c31-19-13-30(8-3-9-37(30)14-19)17-39-29-33-26-12-25(24-11-22(38)10-18-4-1-2-5-23(18)24)35-40-27(26)28(34-29)36-15-20-6-7-21(16-36)32-20/h1-2,4-5,10-12,19-21,32,35,38H,3,6-9,13-17H2/t19?,20?,21?,30-/m0/s1 |
| InChIKey | XBMQICUHXWKIDD-XJLAJMIISA-N |
| XLogP | 4.34 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|