C23H25Cl2FN2O2 — CID 166534584
methyl 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]-3-fluorophenyl]methyl]piperidine-4-carboxylate (PubChem CID 166534584) has the molecular formula C23H25Cl2FN2O2 and a molecular weight of 451.37 g/mol. Its IUPAC name is methyl 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]-3-fluorophenyl]methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]-3-fluorophenyl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 166534584 |
| Molecular Formula | C23H25Cl2FN2O2 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | methyl 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]-3-fluorophenyl]methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cc2ccc(N3CC(c4c(Cl)cccc4Cl)C3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H25Cl2FN2O2/c1-30-23(29)16-7-9-27(10-8-16)12-15-5-6-21(20(26)11-15)28-13-17(14-28)22-18(24)3-2-4-19(22)25/h2-6,11,16-17H,7-10,12-14H2,1H3 |
| InChIKey | PYOCPYLIYOAMLV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|