C21H23Cl2FN2O3 — CID 175982107
1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]-3-fluorophenyl]methyl]-3-methylazetidin-3-ol;formic acid (PubChem CID 175982107) has the molecular formula C21H23Cl2FN2O3 and a molecular weight of 441.33 g/mol. Its IUPAC name is 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]-3-fluorophenyl]methyl]-3-methylazetidin-3-ol;formic acid.
| Compound Name | 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]-3-fluorophenyl]methyl]-3-methylazetidin-3-ol;formic acid |
|---|---|
| PubChem CID | 175982107 |
| Molecular Formula | C21H23Cl2FN2O3 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-[[4-[3-(2,6-dichlorophenyl)azetidin-1-yl]-3-fluorophenyl]methyl]-3-methylazetidin-3-ol;formic acid |
| SMILES | CC1(O)CN(Cc2ccc(N3CC(c4c(Cl)cccc4Cl)C3)c(F)c2)C1.O=CO |
| InChI | InChI=1S/C20H21Cl2FN2O.CH2O2/c1-20(26)11-24(12-20)8-13-5-6-18(17(23)7-13)25-9-14(10-25)19-15(21)3-2-4-16(19)22;2-1-3/h2-7,14,26H,8-12H2,1H3;1H,(H,2,3) |
| InChIKey | AFQIXIZDPVLORB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|