C19H17F2NO — CID 170736513
1-[[4-[2-(2,6-difluorophenyl)ethynyl]phenyl]methyl]-3-methylazetidin-3-ol (PubChem CID 170736513) has the molecular formula C19H17F2NO and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-[[4-[2-(2,6-difluorophenyl)ethynyl]phenyl]methyl]-3-methylazetidin-3-ol.
| Compound Name | 1-[[4-[2-(2,6-difluorophenyl)ethynyl]phenyl]methyl]-3-methylazetidin-3-ol |
|---|---|
| PubChem CID | 170736513 |
| Molecular Formula | C19H17F2NO |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-[[4-[2-(2,6-difluorophenyl)ethynyl]phenyl]methyl]-3-methylazetidin-3-ol |
| SMILES | CC1(O)CN(Cc2ccc(C#Cc3c(F)cccc3F)cc2)C1 |
| InChI | InChI=1S/C19H17F2NO/c1-19(23)12-22(13-19)11-15-7-5-14(6-8-15)9-10-16-17(20)3-2-4-18(16)21/h2-8,23H,11-13H2,1H3 |
| InChIKey | DIPVKQJQCUVGFH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|