C16H26N2O2S — CID 166538063
(2R)-1-[[3-(cyclohexylmethoxy)phenyl]sulfonimidoyl]propan-2-amine (PubChem CID 166538063) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is (2R)-1-[[3-(cyclohexylmethoxy)phenyl]sulfonimidoyl]propan-2-amine.
| Compound Name | (2R)-1-[[3-(cyclohexylmethoxy)phenyl]sulfonimidoyl]propan-2-amine |
|---|---|
| PubChem CID | 166538063 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2R)-1-[[3-(cyclohexylmethoxy)phenyl]sulfonimidoyl]propan-2-amine |
| SMILES | [H]N=S(=O)(C[C@@H](C)N)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C16H26N2O2S/c1-13(17)12-21(18,19)16-9-5-8-15(10-16)20-11-14-6-3-2-4-7-14/h5,8-10,13-14,18H,2-4,6-7,11-12,17H2,1H3/t13-,21?/m1/s1 |
| InChIKey | IROSJWCBGWPURO-ILRUXTBWSA-N |
| XLogP | 3.40 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |