C21H21N7 — CID 166547485
8-N-[3-(3,3-dimethylbut-1-ynyl)phenyl]-8-N-methyl-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-8,12-diamine (PubChem CID 166547485) has the molecular formula C21H21N7 and a molecular weight of 371.45 g/mol. Its IUPAC name is 8-N-[3-(3,3-dimethylbut-1-ynyl)phenyl]-8-N-methyl-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-8,12-diamine.
| Compound Name | 8-N-[3-(3,3-dimethylbut-1-ynyl)phenyl]-8-N-methyl-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-8,12-diamine |
|---|---|
| PubChem CID | 166547485 |
| Molecular Formula | C21H21N7 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 8-N-[3-(3,3-dimethylbut-1-ynyl)phenyl]-8-N-methyl-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-8,12-diamine |
| SMILES | CN(c1cccc(C#CC(C)(C)C)c1)c1nc2nncn2c2nc(N)ccc12 |
| InChI | InChI=1S/C21H21N7/c1-21(2,3)11-10-14-6-5-7-15(12-14)27(4)18-16-8-9-17(22)24-19(16)28-13-23-26-20(28)25-18/h5-9,12-13H,1-4H3,(H2,22,24) |
| InChIKey | XPMLVNJQEHRXIG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|