C21H20N6O2 — CID 166547504
4-[3-[(12-methoxy-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-8-yl)-methylamino]phenyl]-2-methylbut-3-yn-2-ol (PubChem CID 166547504) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[3-[(12-methoxy-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-8-yl)-methylamino]phenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-[(12-methoxy-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-8-yl)-methylamino]phenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 166547504 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-[3-[(12-methoxy-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-8-yl)-methylamino]phenyl]-2-methylbut-3-yn-2-ol |
| SMILES | COc1ccc2c(N(C)c3cccc(C#CC(C)(C)O)c3)nc3nncn3c2n1 |
| InChI | InChI=1S/C21H20N6O2/c1-21(2,28)11-10-14-6-5-7-15(12-14)26(3)18-16-8-9-17(29-4)23-19(16)27-13-22-25-20(27)24-18/h5-9,12-13,28H,1-4H3 |
| InChIKey | ZLEFAGMJEMHYPO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|