C23H25FN6O — CID 166547927
4-[1-[7-amino-8-[amino(methyl)amino]-3-fluoro-1,6-naphthyridin-5-yl]-3,4-dihydro-2H-quinolin-5-yl]-2-methylbut-3-yn-2-ol (PubChem CID 166547927) has the molecular formula C23H25FN6O and a molecular weight of 420.49 g/mol. Its IUPAC name is 4-[1-[7-amino-8-[amino(methyl)amino]-3-fluoro-1,6-naphthyridin-5-yl]-3,4-dihydro-2H-quinolin-5-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[1-[7-amino-8-[amino(methyl)amino]-3-fluoro-1,6-naphthyridin-5-yl]-3,4-dihydro-2H-quinolin-5-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 166547927 |
| Molecular Formula | C23H25FN6O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-[1-[7-amino-8-[amino(methyl)amino]-3-fluoro-1,6-naphthyridin-5-yl]-3,4-dihydro-2H-quinolin-5-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CN(N)c1c(N)nc(N2CCCc3c(C#CC(C)(C)O)cccc32)c2cc(F)cnc12 |
| InChI | InChI=1S/C23H25FN6O/c1-23(2,31)10-9-14-6-4-8-18-16(14)7-5-11-30(18)22-17-12-15(24)13-27-19(17)20(29(3)26)21(25)28-22/h4,6,8,12-13,31H,5,7,11,26H2,1-3H3,(H2,25,28) |
| InChIKey | JIUPPJWVWFGWIR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|