C7H4BrF3N2O — CID 166548142
N-(2-bromo-3-fluoro-4-pyridinyl)-2,2-difluoroacetamide (PubChem CID 166548142) has the molecular formula C7H4BrF3N2O and a molecular weight of 269.02 g/mol. Its IUPAC name is N-(2-bromo-3-fluoro-4-pyridinyl)-2,2-difluoroacetamide.
| Compound Name | N-(2-bromo-3-fluoro-4-pyridinyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 166548142 |
| Molecular Formula | C7H4BrF3N2O |
| Molecular Weight | 269.02 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | N-(2-bromo-3-fluoro-4-pyridinyl)-2,2-difluoroacetamide |
| SMILES | O=C(Nc1ccnc(Br)c1F)C(F)F |
| InChI | InChI=1S/C7H4BrF3N2O/c8-5-4(9)3(1-2-12-5)13-7(14)6(10)11/h1-2,6H,(H,12,13,14) |
| InChIKey | PEYOXLKRWSHHEQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.02 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|