C19H13N5 — CID 166551342
4-[(3-pyridin-4-yl-1H-indazol-5-yl)amino]benzonitrile (PubChem CID 166551342) has the molecular formula C19H13N5 and a molecular weight of 311.35 g/mol. Its IUPAC name is 4-[(3-pyridin-4-yl-1H-indazol-5-yl)amino]benzonitrile.
| Compound Name | 4-[(3-pyridin-4-yl-1H-indazol-5-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 166551342 |
| Molecular Formula | C19H13N5 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-[(3-pyridin-4-yl-1H-indazol-5-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ccc3[nH]nc(-c4ccncc4)c3c2)cc1 |
| InChI | InChI=1S/C19H13N5/c20-12-13-1-3-15(4-2-13)22-16-5-6-18-17(11-16)19(24-23-18)14-7-9-21-10-8-14/h1-11,22H,(H,23,24) |
| InChIKey | MPUAPPQVLLLHKH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |