C23H21FN2O5 — CID 166553583
1-(4-fluorobenzoyl)-N-hydroxy-3-[(6-methoxynaphthalen-2-yl)oxymethyl]azetidine-3-carboxamide (PubChem CID 166553583) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-hydroxy-3-[(6-methoxynaphthalen-2-yl)oxymethyl]azetidine-3-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-hydroxy-3-[(6-methoxynaphthalen-2-yl)oxymethyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 166553583 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-hydroxy-3-[(6-methoxynaphthalen-2-yl)oxymethyl]azetidine-3-carboxamide |
| SMILES | COc1ccc2cc(OCC3(C(=O)NO)CN(C(=O)c4ccc(F)cc4)C3)ccc2c1 |
| InChI | InChI=1S/C23H21FN2O5/c1-30-19-8-4-17-11-20(9-5-16(17)10-19)31-14-23(22(28)25-29)12-26(13-23)21(27)15-2-6-18(24)7-3-15/h2-11,29H,12-14H2,1H3,(H,25,28) |
| InChIKey | IGZPONGKMHMBAF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|