C28H28FNO5 — CID 59322219
ethyl 3-[[4-(4-fluorophenyl)phenoxy]methyl]-1-(4-methoxybenzoyl)pyrrolidine-3-carboxylate (PubChem CID 59322219) has the molecular formula C28H28FNO5 and a molecular weight of 477.53 g/mol. Its IUPAC name is ethyl 3-[[4-(4-fluorophenyl)phenoxy]methyl]-1-(4-methoxybenzoyl)pyrrolidine-3-carboxylate.
| Compound Name | ethyl 3-[[4-(4-fluorophenyl)phenoxy]methyl]-1-(4-methoxybenzoyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 59322219 |
| Molecular Formula | C28H28FNO5 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | ethyl 3-[[4-(4-fluorophenyl)phenoxy]methyl]-1-(4-methoxybenzoyl)pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(COc2ccc(-c3ccc(F)cc3)cc2)CCN(C(=O)c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C28H28FNO5/c1-3-34-27(32)28(16-17-30(18-28)26(31)22-8-12-24(33-2)13-9-22)19-35-25-14-6-21(7-15-25)20-4-10-23(29)11-5-20/h4-15H,3,16-19H2,1-2H3 |
| InChIKey | NNKLJGCOIPRZQV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |