C23H27NO7S — CID 91202371
ethyl 1-(4-methoxybenzoyl)-3-[(4-methylphenyl)-sulfinooxymethyl]pyrrolidine-3-carboxylate (PubChem CID 91202371) has the molecular formula C23H27NO7S and a molecular weight of 461.54 g/mol. Its IUPAC name is ethyl 1-(4-methoxybenzoyl)-3-[(4-methylphenyl)-sulfinooxymethyl]pyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-(4-methoxybenzoyl)-3-[(4-methylphenyl)-sulfinooxymethyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 91202371 |
| Molecular Formula | C23H27NO7S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | ethyl 1-(4-methoxybenzoyl)-3-[(4-methylphenyl)-sulfinooxymethyl]pyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(C(OS(=O)O)c2ccc(C)cc2)CCN(C(=O)c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C23H27NO7S/c1-4-30-22(26)23(20(31-32(27)28)17-7-5-16(2)6-8-17)13-14-24(15-23)21(25)18-9-11-19(29-3)12-10-18/h5-12,20H,4,13-15H2,1-3H3,(H,27,28) |
| InChIKey | MDWDCHPBAPJISK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|