C22H27N7OS3 — CID 166554531
5-(2-aminoethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbaldehyde;2-N-methyl-6-N-thiophen-2-ylsulfanyl-1,3-benzothiazole-2,6-diamine (PubChem CID 166554531) has the molecular formula C22H27N7OS3 and a molecular weight of 501.71 g/mol. Its IUPAC name is 5-(2-aminoethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbaldehyde;2-N-methyl-6-N-thiophen-2-ylsulfanyl-1,3-benzothiazole-2,6-diamine.
| Compound Name | 5-(2-aminoethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbaldehyde;2-N-methyl-6-N-thiophen-2-ylsulfanyl-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 166554531 |
| Molecular Formula | C22H27N7OS3 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 5-(2-aminoethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbaldehyde;2-N-methyl-6-N-thiophen-2-ylsulfanyl-1,3-benzothiazole-2,6-diamine |
| SMILES | CNc1nc2ccc(NSc3cccs3)cc2s1.NCCN1CCCn2nc(C=O)cc2C1 |
| InChI | InChI=1S/C12H11N3S3.C10H16N4O/c1-13-12-14-9-5-4-8(7-10(9)17-12)15-18-11-3-2-6-16-11;11-2-5-13-3-1-4-14-10(7-13)6-9(8-15)12-14/h2-7,15H,1H3,(H,13,14);6,8H,1-5,7,11H2 |
| InChIKey | PMQRONXJSHDAEU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|