C19H18N6OS3 — CID 166554818
5-amino-N-[6-(thiophen-2-ylsulfanylamino)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 166554818) has the molecular formula C19H18N6OS3 and a molecular weight of 442.60 g/mol. Its IUPAC name is 5-amino-N-[6-(thiophen-2-ylsulfanylamino)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 5-amino-N-[6-(thiophen-2-ylsulfanylamino)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166554818 |
| Molecular Formula | C19H18N6OS3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 5-amino-N-[6-(thiophen-2-ylsulfanylamino)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | NC1CCn2nc(C(=O)Nc3nc4ccc(NSc5cccs5)cc4s3)cc2C1 |
| InChI | InChI=1S/C19H18N6OS3/c20-11-5-6-25-13(8-11)10-15(23-25)18(26)22-19-21-14-4-3-12(9-16(14)28-19)24-29-17-2-1-7-27-17/h1-4,7,9-11,24H,5-6,8,20H2,(H,21,22,26) |
| InChIKey | QYFHFVDVVPHPAJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|