C21H35ClN2O2S — CID 166555531
2-amino-1-[4-[4-chloro-2-methyl-6-[(Z)-1-sulfanylprop-1-en-2-yl]phenoxy]piperidin-1-yl]ethanone;ethane (PubChem CID 166555531) has the molecular formula C21H35ClN2O2S and a molecular weight of 415.04 g/mol. Its IUPAC name is 2-amino-1-[4-[4-chloro-2-methyl-6-[(Z)-1-sulfanylprop-1-en-2-yl]phenoxy]piperidin-1-yl]ethanone;ethane.
| Compound Name | 2-amino-1-[4-[4-chloro-2-methyl-6-[(Z)-1-sulfanylprop-1-en-2-yl]phenoxy]piperidin-1-yl]ethanone;ethane |
|---|---|
| PubChem CID | 166555531 |
| Molecular Formula | C21H35ClN2O2S |
| Molecular Weight | 415.04 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-amino-1-[4-[4-chloro-2-methyl-6-[(Z)-1-sulfanylprop-1-en-2-yl]phenoxy]piperidin-1-yl]ethanone;ethane |
| SMILES | C/C(=C/S)c1cc(Cl)cc(C)c1OC1CCN(C(=O)CN)CC1.CC.CC |
| InChI | InChI=1S/C17H23ClN2O2S.2C2H6/c1-11-7-13(18)8-15(12(2)10-23)17(11)22-14-3-5-20(6-4-14)16(21)9-19;2*1-2/h7-8,10,14,23H,3-6,9,19H2,1-2H3;2*1-2H3/b12-10-;; |
| InChIKey | SAHDDLPKAWFRFL-VSXCOVETSA-N |
| XLogP | 5.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.04 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|