About trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol
trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol (PubChem CID 166556250) has the molecular formula C13H16F3N3O3
and a molecular weight of 319.28 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol |
| PubChem CID | 166556250 |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol |
| SMILES | Nc1c([N+](=O)[O-])cc(CN[C@H]2CCC[C@@H]2O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O3/c14-13(15,16)8-4-7(5-10(12(8)17)19(21)22)6-18-9-2-1-3-11(9)20/h4-5,9,11,18,20H,1-3,6,17H2/t9-,11-/m0/s1 |
| InChIKey | JGAQJCBJAKOTLI-ONGXEEELSA-N |
| XLogP | 2.20 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol?
The IUPAC name of trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol (CID 166556250) is trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol.
What is the SMILES notation for trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol?
The canonical SMILES for trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol is Nc1c([N+](=O)[O-])cc(CN[C@H]2CCC[C@@H]2O)cc1C(F)(F)F.
What is the InChIKey of trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol?
The InChIKey is JGAQJCBJAKOTLI-ONGXEEELSA-N. The full InChI is InChI=1S/C13H16F3N3O3/c14-13(15,16)8-4-7(5-10(12(8)17)19(21)22)6-18-9-2-1-3-11(9)20/h4-5,9,11,18,20H,1-3,6,17H2/t9-,11-/m0/s1.
What are the key properties of trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol?
trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol has a molecular weight of 319.28 g/mol, XLogP of 2.20, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-[[4-amino-3-nitro-5-(trifluoromethyl)phenyl]methylamino]cyclopentan-1-ol is sourced from PubChem (CID 166556250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).