C14H16F3N3O — CID 166556294
(3S)-1-[[2-methyl-7-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]pyrrolidin-3-ol (PubChem CID 166556294) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is (3S)-1-[[2-methyl-7-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[[2-methyl-7-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 166556294 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3S)-1-[[2-methyl-7-(trifluoromethyl)-3H-benzimidazol-5-yl]methyl]pyrrolidin-3-ol |
| SMILES | Cc1nc2c(C(F)(F)F)cc(CN3CC[C@H](O)C3)cc2[nH]1 |
| InChI | InChI=1S/C14H16F3N3O/c1-8-18-12-5-9(6-20-3-2-10(21)7-20)4-11(13(12)19-8)14(15,16)17/h4-5,10,21H,2-3,6-7H2,1H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | NCVPOZKWOHDQOI-JTQLQIEISA-N |
| XLogP | 2.46 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |