C12H15NOS — CID 166559603
4-(2,2-dimethylpropyl)-2-(furan-3-yl)-1,3-thiazole (PubChem CID 166559603) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-2-(furan-3-yl)-1,3-thiazole.
| Compound Name | 4-(2,2-dimethylpropyl)-2-(furan-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 166559603 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-2-(furan-3-yl)-1,3-thiazole |
| SMILES | CC(C)(C)Cc1csc(-c2ccoc2)n1 |
| InChI | InChI=1S/C12H15NOS/c1-12(2,3)6-10-8-15-11(13-10)9-4-5-14-7-9/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | QKQNTPHSXWEYMY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |