C12H12N2OS2 — CID 99832043
4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]butanenitrile (PubChem CID 99832043) has the molecular formula C12H12N2OS2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]butanenitrile.
| Compound Name | 4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]butanenitrile |
|---|---|
| PubChem CID | 99832043 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]butanenitrile |
| SMILES | N#CCCCSCc1csc(-c2ccoc2)n1 |
| InChI | InChI=1S/C12H12N2OS2/c13-4-1-2-6-16-8-11-9-17-12(14-11)10-3-5-15-7-10/h3,5,7,9H,1-2,6,8H2 |
| InChIKey | ZGCNGVVQQODTKB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|