C13H12N4O2S2 — CID 71970395
3-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one (PubChem CID 71970395) has the molecular formula C13H12N4O2S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 3-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 71970395 |
| Molecular Formula | C13H12N4O2S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3-[[2-(furan-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one |
| SMILES | C=CCn1c(SCc2csc(-c3ccoc3)n2)n[nH]c1=O |
| InChI | InChI=1S/C13H12N4O2S2/c1-2-4-17-12(18)15-16-13(17)21-8-10-7-20-11(14-10)9-3-5-19-6-9/h2-3,5-7H,1,4,8H2,(H,15,18) |
| InChIKey | UVXKZSNNAPAGQP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|