C8H8ClN5OS2 — CID 71970386
3-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one (PubChem CID 71970386) has the molecular formula C8H8ClN5OS2 and a molecular weight of 289.77 g/mol. Its IUPAC name is 3-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 71970386 |
| Molecular Formula | C8H8ClN5OS2 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-[(5-chlorothiadiazol-4-yl)methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one |
| SMILES | C=CCn1c(SCc2nnsc2Cl)n[nH]c1=O |
| InChI | InChI=1S/C8H8ClN5OS2/c1-2-3-14-7(15)11-12-8(14)16-4-5-6(9)17-13-10-5/h2H,1,3-4H2,(H,11,15) |
| InChIKey | RLJYZHCKDSHWSJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|