About (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol
(1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol (PubChem CID 166559916) has the molecular formula C17H19FN4OS
and a molecular weight of 346.43 g/mol. Its IUPAC name is (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol.
Molecular Properties
| Compound Name | (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol |
| PubChem CID | 166559916 |
| Molecular Formula | C17H19FN4OS |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol |
| SMILES | CCc1cc(Cc2nn(C)nc2-c2ccc(F)cc2[C@@H](C)O)ns1 |
| InChI | InChI=1S/C17H19FN4OS/c1-4-13-8-12(21-24-13)9-16-17(20-22(3)19-16)14-6-5-11(18)7-15(14)10(2)23/h5-8,10,23H,4,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | WRSJHMVUILKGJF-SNVBAGLBSA-N |
| XLogP | 3.28 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol?
The IUPAC name of (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol (CID 166559916) is (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol.
What is the SMILES notation for (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol?
The canonical SMILES for (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol is CCc1cc(Cc2nn(C)nc2-c2ccc(F)cc2[C@@H](C)O)ns1.
What is the InChIKey of (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol?
The InChIKey is WRSJHMVUILKGJF-SNVBAGLBSA-N. The full InChI is InChI=1S/C17H19FN4OS/c1-4-13-8-12(21-24-13)9-16-17(20-22(3)19-16)14-6-5-11(18)7-15(14)10(2)23/h5-8,10,23H,4,9H2,1-3H3/t10-/m1/s1.
What are the key properties of (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol?
(1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol has a molecular weight of 346.43 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[2-[5-[(5-ethyl-1,2-thiazol-3-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethanol is sourced from PubChem (CID 166559916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).