C18H22FN5O3S — CID 176507670
[(1S)-1-[2-[5-[(1-ethylpyrazol-4-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethyl] methanesulfonate (PubChem CID 176507670) has the molecular formula C18H22FN5O3S and a molecular weight of 407.47 g/mol. Its IUPAC name is [(1S)-1-[2-[5-[(1-ethylpyrazol-4-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethyl] methanesulfonate.
| Compound Name | [(1S)-1-[2-[5-[(1-ethylpyrazol-4-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 176507670 |
| Molecular Formula | C18H22FN5O3S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [(1S)-1-[2-[5-[(1-ethylpyrazol-4-yl)methyl]-2-methyltriazol-4-yl]-5-fluorophenyl]ethyl] methanesulfonate |
| SMILES | CCn1cc(Cc2nn(C)nc2-c2ccc(F)cc2[C@H](C)OS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C18H22FN5O3S/c1-5-24-11-13(10-20-24)8-17-18(22-23(3)21-17)15-7-6-14(19)9-16(15)12(2)27-28(4,25)26/h6-7,9-12H,5,8H2,1-4H3/t12-/m0/s1 |
| InChIKey | UEEZCNVBEVLBRH-LBPRGKRZSA-N |
| XLogP | 2.47 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|