About 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide
1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide (PubChem CID 166567883) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide |
| PubChem CID | 166567883 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide |
| SMILES | C[C@H](NC(=O)C1(C#N)CC1)C(C)(C)C |
| InChI | InChI=1S/C11H18N2O/c1-8(10(2,3)4)13-9(14)11(7-12)5-6-11/h8H,5-6H2,1-4H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | KLLFVSDRKKYAPE-QMMMGPOBSA-N |
| XLogP | 1.84 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide?
The IUPAC name of 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide (CID 166567883) is 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide.
What is the SMILES notation for 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide?
The canonical SMILES for 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide is C[C@H](NC(=O)C1(C#N)CC1)C(C)(C)C.
What is the InChIKey of 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide?
The InChIKey is KLLFVSDRKKYAPE-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H18N2O/c1-8(10(2,3)4)13-9(14)11(7-12)5-6-11/h8H,5-6H2,1-4H3,(H,13,14)/t8-/m0/s1.
What are the key properties of 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide?
1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide has a molecular weight of 194.28 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-[(2S)-3,3-dimethylbutan-2-yl]cyclopropane-1-carboxamide is sourced from PubChem (CID 166567883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).