C17H17F3N6O2S — CID 16656837
2-N-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-4-N-(2,2,2-trifluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 16656837) has the molecular formula C17H17F3N6O2S and a molecular weight of 426.42 g/mol. Its IUPAC name is 2-N-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-4-N-(2,2,2-trifluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-4-N-(2,2,2-trifluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 16656837 |
| Molecular Formula | C17H17F3N6O2S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-N-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-4-N-(2,2,2-trifluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CS(=O)(=O)N1CCc2cc(Nc3nc(NCC(F)(F)F)c4cc[nH]c4n3)ccc21 |
| InChI | InChI=1S/C17H17F3N6O2S/c1-29(27,28)26-7-5-10-8-11(2-3-13(10)26)23-16-24-14-12(4-6-21-14)15(25-16)22-9-17(18,19)20/h2-4,6,8H,5,7,9H2,1H3,(H3,21,22,23,24,25) |
| InChIKey | WOZFNMUYBSNNGV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |