C18H20F3N7 — CID 71201223
2-N-(1-propan-2-yl-2,3-dihydroindazol-5-yl)-4-N-(2,2,2-trifluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 71201223) has the molecular formula C18H20F3N7 and a molecular weight of 391.40 g/mol. Its IUPAC name is 2-N-(1-propan-2-yl-2,3-dihydroindazol-5-yl)-4-N-(2,2,2-trifluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(1-propan-2-yl-2,3-dihydroindazol-5-yl)-4-N-(2,2,2-trifluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71201223 |
| Molecular Formula | C18H20F3N7 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-N-(1-propan-2-yl-2,3-dihydroindazol-5-yl)-4-N-(2,2,2-trifluoroethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CC(C)N1NCc2cc(Nc3nc(NCC(F)(F)F)c4cc[nH]c4n3)ccc21 |
| InChI | InChI=1S/C18H20F3N7/c1-10(2)28-14-4-3-12(7-11(14)8-24-28)25-17-26-15-13(5-6-22-15)16(27-17)23-9-18(19,20)21/h3-7,10,24H,8-9H2,1-2H3,(H3,22,23,25,26,27) |
| InChIKey | GCXHMRMBOTZRGO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |