C23H24F6N6O3 — CID 87783144
N-cyclohexyl-4-[[4-(2,2,2-trifluoroethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 87783144) has the molecular formula C23H24F6N6O3 and a molecular weight of 546.47 g/mol. Its IUPAC name is N-cyclohexyl-4-[[4-(2,2,2-trifluoroethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclohexyl-4-[[4-(2,2,2-trifluoroethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87783144 |
| Molecular Formula | C23H24F6N6O3 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | N-cyclohexyl-4-[[4-(2,2,2-trifluoroethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC1CCCCC1)c1ccc(Nc2nc(NCC(F)(F)F)c3cc[nH]c3n2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23F3N6O.C2HF3O2/c22-21(23,24)12-26-18-16-10-11-25-17(16)29-20(30-18)28-15-8-6-13(7-9-15)19(31)27-14-4-2-1-3-5-14;3-2(4,5)1(6)7/h6-11,14H,1-5,12H2,(H,27,31)(H3,25,26,28,29,30);(H,6,7) |
| InChIKey | FBLQBLUAQMPJQO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |