C46H30N4 — CID 166569017
7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-diphenylbenzo[f]quinoline (PubChem CID 166569017) has the molecular formula C46H30N4 and a molecular weight of 638.77 g/mol. Its IUPAC name is 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-diphenylbenzo[f]quinoline.
| Compound Name | 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-diphenylbenzo[f]quinoline |
|---|---|
| PubChem CID | 166569017 |
| Molecular Formula | C46H30N4 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-diphenylbenzo[f]quinoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c3c(ccc4c(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)cccc43)n2)cc1 |
| InChI | InChI=1S/C46H30N4/c1-5-15-31(16-6-1)40-30-42(32-17-7-2-8-18-32)47-41-28-27-38-37(25-14-26-39(38)43(40)41)35-23-13-24-36(29-35)46-49-44(33-19-9-3-10-20-33)48-45(50-46)34-21-11-4-12-22-34/h1-30H |
| InChIKey | YDTSIVLGDNUSBC-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|