C50H32N4 — CID 166569182
7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-naphthalen-2-yl-3-phenylbenzo[f]quinoline (PubChem CID 166569182) has the molecular formula C50H32N4 and a molecular weight of 688.83 g/mol. Its IUPAC name is 7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-naphthalen-2-yl-3-phenylbenzo[f]quinoline.
| Compound Name | 7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-naphthalen-2-yl-3-phenylbenzo[f]quinoline |
|---|---|
| PubChem CID | 166569182 |
| Molecular Formula | C50H32N4 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-naphthalen-2-yl-3-phenylbenzo[f]quinoline |
| SMILES | c1ccc(-c2cc(-c3ccc4ccccc4c3)c3c(ccc4c(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)cccc43)n2)cc1 |
| InChI | InChI=1S/C50H32N4/c1-4-14-35(15-5-1)46-32-44(40-28-23-33-13-10-11-20-39(33)31-40)47-43-22-12-21-41(42(43)29-30-45(47)51-46)34-24-26-38(27-25-34)50-53-48(36-16-6-2-7-17-36)52-49(54-50)37-18-8-3-9-19-37/h1-32H |
| InChIKey | DYJMZDSAZVQQLP-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|