C40H48IrNO3- — CID 166570117
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)furo[2,3-c]quinoline;(Z)-5-deuterio-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium (PubChem CID 166570117) has the molecular formula C40H48IrNO3- and a molecular weight of 784.05 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)furo[2,3-c]quinoline;(Z)-5-deuterio-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)furo[2,3-c]quinoline;(Z)-5-deuterio-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 166570117 |
| Molecular Formula | C40H48IrNO3- |
| Molecular Weight | 784.05 g/mol |
| Exact Mass | 784.33 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)furo[2,3-c]quinoline;(Z)-5-deuterio-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium |
| SMILES | CC(C)(C)c1cc(-c2nc3ccccc3c3ccoc23)[c-]c2ccccc12.[2H]/C(C(=O)C(C)(CC)CC)=C(/O)C(C)(CC)CC.[Ir] |
| InChI | InChI=1S/C25H20NO.C15H28O2.Ir/c1-25(2,3)21-15-17(14-16-8-4-5-9-18(16)21)23-24-20(12-13-27-24)19-10-6-7-11-22(19)26-23;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h4-13,15H,1-3H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-;/i;11D; |
| InChIKey | HEFKWZRGWUEOGL-SVWJDFHWSA-N |
| XLogP | 11.55 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.05 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|