C36H40IrNO2S- — CID 166570232
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]quinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 166570232) has the molecular formula C36H40IrNO2S- and a molecular weight of 743.01 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]quinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]quinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 166570232 |
| Molecular Formula | C36H40IrNO2S- |
| Molecular Weight | 743.01 g/mol |
| Exact Mass | 743.24 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)thieno[2,3-c]quinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.CC(C)(C)c1cc(-c2nc3ccccc3c3ccsc23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C25H20NS.C11H20O2.Ir/c1-25(2,3)21-15-17(14-16-8-4-5-9-18(16)21)23-24-20(12-13-27-24)19-10-6-7-11-22(19)26-23;1-10(2,3)8(12)7-9(13)11(4,5)6;/h4-13,15H,1-3H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | INHUYQCFMWJYOW-HXIBTQJOSA-N |
| XLogP | 10.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.01 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|