C37H43IrN2O3- — CID 166570354
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-methyl-4-(1-propan-2-yl-4H-isoquinolin-4-id-3-yl)furo[3,2-c]quinoline (PubChem CID 166570354) has the molecular formula C37H43IrN2O3- and a molecular weight of 755.98 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-methyl-4-(1-propan-2-yl-4H-isoquinolin-4-id-3-yl)furo[3,2-c]quinoline.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-methyl-4-(1-propan-2-yl-4H-isoquinolin-4-id-3-yl)furo[3,2-c]quinoline |
|---|---|
| PubChem CID | 166570354 |
| Molecular Formula | C37H43IrN2O3- |
| Molecular Weight | 755.98 g/mol |
| Exact Mass | 756.29 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-methyl-4-(1-propan-2-yl-4H-isoquinolin-4-id-3-yl)furo[3,2-c]quinoline |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc2c(-c3[c-]c4ccccc4c(C(C)C)n3)nc3ccccc3c2o1.[Ir] |
| InChI | InChI=1S/C24H19N2O.C13H24O2.Ir/c1-14(2)22-17-9-5-4-8-16(17)13-21(26-22)23-19-12-15(3)27-24(19)18-10-6-7-11-20(18)25-23;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-12,14H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | UODZIRPOCSQFJW-DZTQYQPZSA-N |
| XLogP | 10.30 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.98 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|