C10H17FO4S — CID 166570805
(1,1-dioxothiolan-3-yl)methyl 2-fluoro-2-methylbutanoate (PubChem CID 166570805) has the molecular formula C10H17FO4S and a molecular weight of 252.31 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)methyl 2-fluoro-2-methylbutanoate.
| Compound Name | (1,1-dioxothiolan-3-yl)methyl 2-fluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 166570805 |
| Molecular Formula | C10H17FO4S |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)methyl 2-fluoro-2-methylbutanoate |
| SMILES | CCC(C)(F)C(=O)OCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17FO4S/c1-3-10(2,11)9(12)15-6-8-4-5-16(13,14)7-8/h8H,3-7H2,1-2H3 |
| InChIKey | ROOOZHGNPBHNAY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |