C47H42IrN2OSi-2 — CID 166575519
iridium;1-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-4a,5,6,7,8,8a-hexahydroisoquinoline;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]silane (PubChem CID 166575519) has the molecular formula C47H42IrN2OSi-2 and a molecular weight of 871.17 g/mol. Its IUPAC name is iridium;1-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-4a,5,6,7,8,8a-hexahydroisoquinoline;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]silane.
| Compound Name | iridium;1-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-4a,5,6,7,8,8a-hexahydroisoquinoline;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 166575519 |
| Molecular Formula | C47H42IrN2OSi-2 |
| Molecular Weight | 871.17 g/mol |
| Exact Mass | 871.27 |
| IUPAC Name | iridium;1-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-4a,5,6,7,8,8a-hexahydroisoquinoline;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]ccc(-c3ccccc3)c2)nc1.[Ir].[c-]1ccc2c(oc3cc(-c4ccccc4)ccc32)c1C1=NC=CC2CCCCC12 |
| InChI | InChI=1S/C27H22NO.C20H20NSi.Ir/c1-2-7-18(8-3-1)20-13-14-22-23-11-6-12-24(27(23)29-25(22)17-20)26-21-10-5-4-9-19(21)15-16-28-26;1-22(2,3)19-12-13-20(21-15-19)18-11-7-10-17(14-18)16-8-5-4-6-9-16;/h1-3,6-8,11,13-17,19,21H,4-5,9-10H2;4-10,12-15H,1-3H3;/q2*-1; |
| InChIKey | JHOJLPKODPEVDQ-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.17 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|