C24H29NSi — CID 166578341
[6-(2,4-dimethyl-5-phenylphenyl)-4-methyl-1-methylidenepyridin-1-ium-6-id-3-yl]-trimethylsilane (PubChem CID 166578341) has the molecular formula C24H29NSi and a molecular weight of 359.59 g/mol. Its IUPAC name is [6-(2,4-dimethyl-5-phenylphenyl)-4-methyl-1-methylidenepyridin-1-ium-6-id-3-yl]-trimethylsilane.
| Compound Name | [6-(2,4-dimethyl-5-phenylphenyl)-4-methyl-1-methylidenepyridin-1-ium-6-id-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 166578341 |
| Molecular Formula | C24H29NSi |
| Molecular Weight | 359.59 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [6-(2,4-dimethyl-5-phenylphenyl)-4-methyl-1-methylidenepyridin-1-ium-6-id-3-yl]-trimethylsilane |
| SMILES | C=[N+]1C=C([Si](C)(C)C)C(C)=C[C-]1c1cc(-c2ccccc2)c(C)cc1C |
| InChI | InChI=1S/C24H29NSi/c1-17-13-18(2)22(15-21(17)20-11-9-8-10-12-20)23-14-19(3)24(16-25(23)4)26(5,6)7/h8-16H,4H2,1-3,5-7H3 |
| InChIKey | KVLSTEINRBACBT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|