C29H37NSi — CID 166575824
[4-(cyclopentylmethyl)-6-(2,5-dimethyl-4-phenylphenyl)-1-methylidenepyridin-1-ium-6-id-3-yl]-trimethylsilane (PubChem CID 166575824) has the molecular formula C29H37NSi and a molecular weight of 427.71 g/mol. Its IUPAC name is [4-(cyclopentylmethyl)-6-(2,5-dimethyl-4-phenylphenyl)-1-methylidenepyridin-1-ium-6-id-3-yl]-trimethylsilane.
| Compound Name | [4-(cyclopentylmethyl)-6-(2,5-dimethyl-4-phenylphenyl)-1-methylidenepyridin-1-ium-6-id-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 166575824 |
| Molecular Formula | C29H37NSi |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | [4-(cyclopentylmethyl)-6-(2,5-dimethyl-4-phenylphenyl)-1-methylidenepyridin-1-ium-6-id-3-yl]-trimethylsilane |
| SMILES | C=[N+]1C=C([Si](C)(C)C)C(CC2CCCC2)=C[C-]1c1cc(C)c(-c2ccccc2)cc1C |
| InChI | InChI=1S/C29H37NSi/c1-21-17-27(22(2)16-26(21)24-14-8-7-9-15-24)28-19-25(18-23-12-10-11-13-23)29(20-30(28)3)31(4,5)6/h7-9,14-17,19-20,23H,3,10-13,18H2,1-2,4-6H3 |
| InChIKey | QUTXWDLVKYJPRA-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|