C15H18ClN5O4S — CID 16657879
(2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 16657879) has the molecular formula C15H18ClN5O4S and a molecular weight of 399.86 g/mol. Its IUPAC name is (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 16657879 |
| Molecular Formula | C15H18ClN5O4S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | (2S)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc2c(Cl)cnc(N=C(N)N)c2c1)C(=O)O |
| InChI | InChI=1S/C15H18ClN5O4S/c1-7(2)12(14(22)23)21-26(24,25)8-3-4-9-10(5-8)13(20-15(17)18)19-6-11(9)16/h3-7,12,21H,1-2H3,(H,22,23)(H4,17,18,19,20)/t12-/m0/s1 |
| InChIKey | SGNWRRWWDNCCEY-LBPRGKRZSA-N |
| XLogP | 1.18 |
| TPSA | 160.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|