C16H20ClN5O4S — CID 16657882
(2R)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3,3-dimethylbutanoic acid (PubChem CID 16657882) has the molecular formula C16H20ClN5O4S and a molecular weight of 413.89 g/mol. Its IUPAC name is (2R)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 16657882 |
| Molecular Formula | C16H20ClN5O4S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (2R)-2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](NS(=O)(=O)c1ccc2c(Cl)cnc(N=C(N)N)c2c1)C(=O)O |
| InChI | InChI=1S/C16H20ClN5O4S/c1-16(2,3)12(14(23)24)22-27(25,26)8-4-5-9-10(6-8)13(21-15(18)19)20-7-11(9)17/h4-7,12,22H,1-3H3,(H,23,24)(H4,18,19,20,21)/t12-/m0/s1 |
| InChIKey | ORKRWULAVSUPRP-LBPRGKRZSA-N |
| XLogP | 1.57 |
| TPSA | 160.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|