C26H51N7O3 — CID 166579210
N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-7-ylmethyl)-3-[[2-amino-2-[[amino(1,3-diazinan-4-yl)methyl]-(3-hydroxypropyl)amino]ethyl]amino]cyclohexane-1-carboxamide (PubChem CID 166579210) has the molecular formula C26H51N7O3 and a molecular weight of 509.74 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-7-ylmethyl)-3-[[2-amino-2-[[amino(1,3-diazinan-4-yl)methyl]-(3-hydroxypropyl)amino]ethyl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-7-ylmethyl)-3-[[2-amino-2-[[amino(1,3-diazinan-4-yl)methyl]-(3-hydroxypropyl)amino]ethyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166579210 |
| Molecular Formula | C26H51N7O3 |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.41 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-7-ylmethyl)-3-[[2-amino-2-[[amino(1,3-diazinan-4-yl)methyl]-(3-hydroxypropyl)amino]ethyl]amino]cyclohexane-1-carboxamide |
| SMILES | NC(CNC1CCCC(C(=O)NCC2CCCC3CCOC32)C1)N(CCCO)C(N)C1CCNCN1 |
| InChI | InChI=1S/C26H51N7O3/c27-23(33(11-3-12-34)25(28)22-8-10-29-17-32-22)16-30-21-7-2-5-19(14-21)26(35)31-15-20-6-1-4-18-9-13-36-24(18)20/h18-25,29-30,32,34H,1-17,27-28H2,(H,31,35) |
| InChIKey | BALRTPJNJQKVAU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 149.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|