C24H22F3N3O2 — CID 166579518
3-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]methylamino]piperidine-2,6-dione (PubChem CID 166579518) has the molecular formula C24H22F3N3O2 and a molecular weight of 441.45 g/mol. Its IUPAC name is 3-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]methylamino]piperidine-2,6-dione.
| Compound Name | 3-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]methylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166579518 |
| Molecular Formula | C24H22F3N3O2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]methylamino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NCC2CC(c3c(-c4ccc(F)cc4)[nH]c4c(F)cc(F)cc34)C2)C(=O)N1 |
| InChI | InChI=1S/C24H22F3N3O2/c25-15-3-1-13(2-4-15)22-21(17-9-16(26)10-18(27)23(17)30-22)14-7-12(8-14)11-28-19-5-6-20(31)29-24(19)32/h1-4,9-10,12,14,19,28,30H,5-8,11H2,(H,29,31,32) |
| InChIKey | QQYNIBLALOPYMT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|