C25H21F3N2O3 — CID 167610430
3-[2-[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]-2-oxoethyl]piperidine-2,6-dione (PubChem CID 167610430) has the molecular formula C25H21F3N2O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is 3-[2-[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]-2-oxoethyl]piperidine-2,6-dione.
| Compound Name | 3-[2-[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]-2-oxoethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167610430 |
| Molecular Formula | C25H21F3N2O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3-[2-[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]-2-oxoethyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(CC(=O)C2CC(c3c(-c4ccc(F)cc4)[nH]c4c(F)cc(F)cc34)C2)C(=O)N1 |
| InChI | InChI=1S/C25H21F3N2O3/c26-16-4-1-12(2-5-16)23-22(18-10-17(27)11-19(28)24(18)30-23)15-7-14(8-15)20(31)9-13-3-6-21(32)29-25(13)33/h1-2,4-5,10-11,13-15,30H,3,6-9H2,(H,29,32,33) |
| InChIKey | KYURYJHEKDXNDI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|