C22H24F3N7O — CID 166580613
2-[6-[methyl-[(1R,2S,3R,5S)-2-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(1H-pyrazol-4-yl)phenol (PubChem CID 166580613) has the molecular formula C22H24F3N7O and a molecular weight of 459.48 g/mol. Its IUPAC name is 2-[6-[methyl-[(1R,2S,3R,5S)-2-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(1H-pyrazol-4-yl)phenol.
| Compound Name | 2-[6-[methyl-[(1R,2S,3R,5S)-2-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(1H-pyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 166580613 |
| Molecular Formula | C22H24F3N7O |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[6-[methyl-[(1R,2S,3R,5S)-2-(trifluoromethyl)-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(1H-pyrazol-4-yl)phenol |
| SMILES | CN(c1cnc(-c2ccc(-c3cn[nH]c3)cc2O)nn1)[C@@H]1C[C@@H]2CCC[C@@H](N2)[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C22H24F3N7O/c1-32(17-8-14-3-2-4-16(29-14)20(17)22(23,24)25)19-11-26-21(31-30-19)15-6-5-12(7-18(15)33)13-9-27-28-10-13/h5-7,9-11,14,16-17,20,29,33H,2-4,8H2,1H3,(H,27,28)/t14-,16+,17+,20-/m0/s1 |
| InChIKey | YDSPKJMVBIEFQJ-MCNSXXNHSA-N |
| XLogP | 3.53 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |