C60H36N6O — CID 166583159
7-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-(11-phenylindolo[2,3-a]carbazol-12-yl)-1,3,5-triazin-2-yl]-2-phenyl-1,3-benzoxazole (PubChem CID 166583159) has the molecular formula C60H36N6O and a molecular weight of 862.02 g/mol. Its IUPAC name is 7-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-(11-phenylindolo[2,3-a]carbazol-12-yl)-1,3,5-triazin-2-yl]-2-phenyl-1,3-benzoxazole.
| Compound Name | 7-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-(11-phenylindolo[2,3-a]carbazol-12-yl)-1,3,5-triazin-2-yl]-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 166583159 |
| Molecular Formula | C60H36N6O |
| Molecular Weight | 862.02 g/mol |
| Exact Mass | 861.33 |
| IUPAC Name | 7-[4-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-6-(11-phenylindolo[2,3-a]carbazol-12-yl)-1,3,5-triazin-2-yl]-2-phenyl-1,3-benzoxazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3nc(-c4cccc5nc(-c6ccccc6)oc45)nc(-n4c5ccccc5c5ccc6c7ccccc7n(-c7ccccc7)c6c54)n3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C60H36N6O/c1-4-19-37(20-5-1)52-42-27-10-12-29-44(42)53(45-30-13-11-28-43(45)52)58-62-57(48-31-18-32-49-56(48)67-59(61-49)38-21-6-2-7-22-38)63-60(64-58)66-51-34-17-15-26-41(51)47-36-35-46-40-25-14-16-33-50(40)65(54(46)55(47)66)39-23-8-3-9-24-39/h1-36H/i1D,4D,5D,19D,20D |
| InChIKey | AKPUYIAHKYIMJD-JIOYQBSQSA-N |
| XLogP | 15.18 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.02 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|