C33H40F2N10O3 — CID 166586210
N-[1-[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]piperidin-3-yl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylbenzamide (PubChem CID 166586210) has the molecular formula C33H40F2N10O3 and a molecular weight of 662.75 g/mol. Its IUPAC name is N-[1-[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]piperidin-3-yl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylbenzamide.
| Compound Name | N-[1-[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]piperidin-3-yl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylbenzamide |
|---|---|
| PubChem CID | 166586210 |
| Molecular Formula | C33H40F2N10O3 |
| Molecular Weight | 662.75 g/mol |
| Exact Mass | 662.33 |
| IUPAC Name | N-[1-[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]piperidin-3-yl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylbenzamide |
| SMILES | CCc1cc(Nc2nccn3c(-c4ccc(OC)c(F)c4F)cnc23)ccc1C(=O)NC1CCCN(C(=O)[C@H](N)CCCN=C(N)N)C1 |
| InChI | InChI=1S/C33H40F2N10O3/c1-3-19-16-20(42-29-30-41-17-25(45(30)15-13-39-29)23-10-11-26(48-2)28(35)27(23)34)8-9-22(19)31(46)43-21-6-5-14-44(18-21)32(47)24(36)7-4-12-40-33(37)38/h8-11,13,15-17,21,24H,3-7,12,14,18,36H2,1-2H3,(H,39,42)(H,43,46)(H4,37,38,40)/t21?,24-/m1/s1 |
| InChIKey | LXBYKWYCDDOCFP-MQNHUJCZSA-N |
| XLogP | 3.09 |
| TPSA | 191.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.75 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|