C29H29N3O6 — CID 166588006
dimethyl (2S)-2-[[13-(2-aminoanilino)-2-oxotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-5-carbonyl]amino]pentanedioate (PubChem CID 166588006) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is dimethyl (2S)-2-[[13-(2-aminoanilino)-2-oxotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-5-carbonyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[13-(2-aminoanilino)-2-oxotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-5-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 166588006 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | dimethyl (2S)-2-[[13-(2-aminoanilino)-2-oxotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-5-carbonyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)c1ccc2c(c1)C(=O)c1ccc(Nc3ccccc3N)cc1CC2)C(=O)OC |
| InChI | InChI=1S/C29H29N3O6/c1-37-26(33)14-13-25(29(36)38-2)32-28(35)19-10-8-17-7-9-18-15-20(31-24-6-4-3-5-23(24)30)11-12-21(18)27(34)22(17)16-19/h3-6,8,10-12,15-16,25,31H,7,9,13-14,30H2,1-2H3,(H,32,35)/t25-/m0/s1 |
| InChIKey | AEEHNIODOCKKPJ-VWLOTQADSA-N |
| XLogP | 3.57 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|